![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Table S7 Difference in ORF.xlsx | 2021-04-13 06:07 | 8.9K | |
| Revised Table S3 Chromosome rearrangement events.xlsx | 2021-04-13 06:07 | 9.6K | |
| Revised Supplementary Table Caption.docx | 2021-04-13 06:07 | 11K | |
| Table S8 Oligos for fosmid cloning and sequencing.xlsx | 2021-04-13 06:07 | 13K | |
| Table S6 Break induced replication.xlsx | 2021-04-13 06:07 | 16K | |
| Table S1 Sequencing metrics.xlsx | 2021-04-13 06:07 | 16K | |
| Revised Table S6 Break induced replication.xlsx | 2021-04-13 06:07 | 18K | |
| Revised Table S2 SNV and structural variant.xlsx | 2021-04-13 06:07 | 23K | |
| Table S5 Subtelomere structure.xlsx | 2021-04-13 06:07 | 24K | |
| Table S4 Mobility of LTR.xlsx | 2021-04-13 06:07 | 136K | |